C16H16F2N2O — CID 43549828
N-(5-amino-2,4-difluorophenyl)-4-propan-2-ylbenzamide (PubChem CID 43549828) has the molecular formula C16H16F2N2O and a molecular weight of 290.31 g/mol. Its IUPAC name is N-(5-amino-2,4-difluorophenyl)-4-propan-2-ylbenzamide.
| Compound Name | N-(5-amino-2,4-difluorophenyl)-4-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 43549828 |
| Molecular Formula | C16H16F2N2O |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | N-(5-amino-2,4-difluorophenyl)-4-propan-2-ylbenzamide |
| SMILES | CC(C)c1ccc(C(=O)Nc2cc(N)c(F)cc2F)cc1 |
| InChI | InChI=1S/C16H16F2N2O/c1-9(2)10-3-5-11(6-4-10)16(21)20-15-8-14(19)12(17)7-13(15)18/h3-9H,19H2,1-2H3,(H,20,21) |
| InChIKey | XHHXQHJYKJHKDC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|