About 2-[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]ethanesulfonamide
2-[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]ethanesulfonamide (PubChem CID 43551602) has the molecular formula C8H11N5O3S
and a molecular weight of 257.27 g/mol. Its IUPAC name is 2-[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]ethanesulfonamide.
Molecular Properties
| Compound Name | 2-[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]ethanesulfonamide |
| PubChem CID | 43551602 |
| Molecular Formula | C8H11N5O3S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 2-[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]ethanesulfonamide |
| SMILES | Nc1ccc(NCCS(N)(=O)=O)c2nonc12 |
| InChI | InChI=1S/C8H11N5O3S/c9-5-1-2-6(8-7(5)12-16-13-8)11-3-4-17(10,14)15/h1-2,11H,3-4,9H2,(H2,10,14,15) |
| InChIKey | OKCKGORYCWZKPE-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 137.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]ethanesulfonamide?
The IUPAC name of 2-[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]ethanesulfonamide (CID 43551602) is 2-[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]ethanesulfonamide.
What is the SMILES notation for 2-[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]ethanesulfonamide?
The canonical SMILES for 2-[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]ethanesulfonamide is Nc1ccc(NCCS(N)(=O)=O)c2nonc12.
What is the InChIKey of 2-[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]ethanesulfonamide?
The InChIKey is OKCKGORYCWZKPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5O3S/c9-5-1-2-6(8-7(5)12-16-13-8)11-3-4-17(10,14)15/h1-2,11H,3-4,9H2,(H2,10,14,15).
What are the key properties of 2-[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]ethanesulfonamide?
2-[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]ethanesulfonamide has a molecular weight of 257.27 g/mol, XLogP of -0.49, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]ethanesulfonamide is sourced from PubChem (CID 43551602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).