About 2-[(4-bromo-2-oxo-1,3-dihydroindol-3-yl)amino]ethanesulfonamide
2-[(4-bromo-2-oxo-1,3-dihydroindol-3-yl)amino]ethanesulfonamide (PubChem CID 43551820) has the molecular formula C10H12BrN3O3S
and a molecular weight of 334.20 g/mol. Its IUPAC name is 2-[(4-bromo-2-oxo-1,3-dihydroindol-3-yl)amino]ethanesulfonamide.
Molecular Properties
| Compound Name | 2-[(4-bromo-2-oxo-1,3-dihydroindol-3-yl)amino]ethanesulfonamide |
| PubChem CID | 43551820 |
| Molecular Formula | C10H12BrN3O3S |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | 2-[(4-bromo-2-oxo-1,3-dihydroindol-3-yl)amino]ethanesulfonamide |
| SMILES | NS(=O)(=O)CCNC1C(=O)Nc2cccc(Br)c21 |
| InChI | InChI=1S/C10H12BrN3O3S/c11-6-2-1-3-7-8(6)9(10(15)14-7)13-4-5-18(12,16)17/h1-3,9,13H,4-5H2,(H,14,15)(H2,12,16,17) |
| InChIKey | BZNSGGHQKRIBKV-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(4-bromo-2-oxo-1,3-dihydroindol-3-yl)amino]ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-bromo-2-oxo-1,3-dihydroindol-3-yl)amino]ethanesulfonamide?
The IUPAC name of 2-[(4-bromo-2-oxo-1,3-dihydroindol-3-yl)amino]ethanesulfonamide (CID 43551820) is 2-[(4-bromo-2-oxo-1,3-dihydroindol-3-yl)amino]ethanesulfonamide.
What is the SMILES notation for 2-[(4-bromo-2-oxo-1,3-dihydroindol-3-yl)amino]ethanesulfonamide?
The canonical SMILES for 2-[(4-bromo-2-oxo-1,3-dihydroindol-3-yl)amino]ethanesulfonamide is NS(=O)(=O)CCNC1C(=O)Nc2cccc(Br)c21.
What is the InChIKey of 2-[(4-bromo-2-oxo-1,3-dihydroindol-3-yl)amino]ethanesulfonamide?
The InChIKey is BZNSGGHQKRIBKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrN3O3S/c11-6-2-1-3-7-8(6)9(10(15)14-7)13-4-5-18(12,16)17/h1-3,9,13H,4-5H2,(H,14,15)(H2,12,16,17).
What are the key properties of 2-[(4-bromo-2-oxo-1,3-dihydroindol-3-yl)amino]ethanesulfonamide?
2-[(4-bromo-2-oxo-1,3-dihydroindol-3-yl)amino]ethanesulfonamide has a molecular weight of 334.20 g/mol, XLogP of 0.32, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-bromo-2-oxo-1,3-dihydroindol-3-yl)amino]ethanesulfonamide is sourced from PubChem (CID 43551820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).