C10H13N3O2S — CID 43551880
2-[(4-cyanophenyl)methylamino]ethanesulfonamide (PubChem CID 43551880) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)methylamino]ethanesulfonamide.
| Compound Name | 2-[(4-cyanophenyl)methylamino]ethanesulfonamide |
|---|---|
| PubChem CID | 43551880 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 2-[(4-cyanophenyl)methylamino]ethanesulfonamide |
| SMILES | N#Cc1ccc(CNCCS(N)(=O)=O)cc1 |
| InChI | InChI=1S/C10H13N3O2S/c11-7-9-1-3-10(4-2-9)8-13-5-6-16(12,14)15/h1-4,13H,5-6,8H2,(H2,12,14,15) |
| InChIKey | MIVVBHVLCSIFFA-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|