About N-[(4,6-dimethoxypyrimidin-5-yl)methyl]cyclopropanamine
N-[(4,6-dimethoxypyrimidin-5-yl)methyl]cyclopropanamine (PubChem CID 43552089) has the molecular formula C10H15N3O2
and a molecular weight of 209.25 g/mol. Its IUPAC name is N-[(4,6-dimethoxypyrimidin-5-yl)methyl]cyclopropanamine.
Molecular Properties
| Compound Name | N-[(4,6-dimethoxypyrimidin-5-yl)methyl]cyclopropanamine |
| PubChem CID | 43552089 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | N-[(4,6-dimethoxypyrimidin-5-yl)methyl]cyclopropanamine |
| SMILES | COc1ncnc(OC)c1CNC1CC1 |
| InChI | InChI=1S/C10H15N3O2/c1-14-9-8(5-11-7-3-4-7)10(15-2)13-6-12-9/h6-7,11H,3-5H2,1-2H3 |
| InChIKey | AXLBMACKLOGMNW-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(4,6-dimethoxypyrimidin-5-yl)methyl]cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4,6-dimethoxypyrimidin-5-yl)methyl]cyclopropanamine?
The IUPAC name of N-[(4,6-dimethoxypyrimidin-5-yl)methyl]cyclopropanamine (CID 43552089) is N-[(4,6-dimethoxypyrimidin-5-yl)methyl]cyclopropanamine.
What is the SMILES notation for N-[(4,6-dimethoxypyrimidin-5-yl)methyl]cyclopropanamine?
The canonical SMILES for N-[(4,6-dimethoxypyrimidin-5-yl)methyl]cyclopropanamine is COc1ncnc(OC)c1CNC1CC1.
What is the InChIKey of N-[(4,6-dimethoxypyrimidin-5-yl)methyl]cyclopropanamine?
The InChIKey is AXLBMACKLOGMNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O2/c1-14-9-8(5-11-7-3-4-7)10(15-2)13-6-12-9/h6-7,11H,3-5H2,1-2H3.
What are the key properties of N-[(4,6-dimethoxypyrimidin-5-yl)methyl]cyclopropanamine?
N-[(4,6-dimethoxypyrimidin-5-yl)methyl]cyclopropanamine has a molecular weight of 209.25 g/mol, XLogP of 0.75, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4,6-dimethoxypyrimidin-5-yl)methyl]cyclopropanamine is sourced from PubChem (CID 43552089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).