About 1-(4,6-dimethoxypyrimidin-5-yl)-N-methylmethanamine
1-(4,6-dimethoxypyrimidin-5-yl)-N-methylmethanamine (PubChem CID 43552092) has the molecular formula C8H13N3O2
and a molecular weight of 183.21 g/mol. Its IUPAC name is 1-(4,6-dimethoxypyrimidin-5-yl)-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-(4,6-dimethoxypyrimidin-5-yl)-N-methylmethanamine |
| PubChem CID | 43552092 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 1-(4,6-dimethoxypyrimidin-5-yl)-N-methylmethanamine |
| SMILES | CNCc1c(OC)ncnc1OC |
| InChI | InChI=1S/C8H13N3O2/c1-9-4-6-7(12-2)10-5-11-8(6)13-3/h5,9H,4H2,1-3H3 |
| InChIKey | GKIWZJVYRCZDHO-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4,6-dimethoxypyrimidin-5-yl)-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,6-dimethoxypyrimidin-5-yl)-N-methylmethanamine?
The IUPAC name of 1-(4,6-dimethoxypyrimidin-5-yl)-N-methylmethanamine (CID 43552092) is 1-(4,6-dimethoxypyrimidin-5-yl)-N-methylmethanamine.
What is the SMILES notation for 1-(4,6-dimethoxypyrimidin-5-yl)-N-methylmethanamine?
The canonical SMILES for 1-(4,6-dimethoxypyrimidin-5-yl)-N-methylmethanamine is CNCc1c(OC)ncnc1OC.
What is the InChIKey of 1-(4,6-dimethoxypyrimidin-5-yl)-N-methylmethanamine?
The InChIKey is GKIWZJVYRCZDHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2/c1-9-4-6-7(12-2)10-5-11-8(6)13-3/h5,9H,4H2,1-3H3.
What are the key properties of 1-(4,6-dimethoxypyrimidin-5-yl)-N-methylmethanamine?
1-(4,6-dimethoxypyrimidin-5-yl)-N-methylmethanamine has a molecular weight of 183.21 g/mol, XLogP of 0.21, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,6-dimethoxypyrimidin-5-yl)-N-methylmethanamine is sourced from PubChem (CID 43552092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).