C15H28N4O2 — CID 43552126
N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-N',N'-di(propan-2-yl)ethane-1,2-diamine (PubChem CID 43552126) has the molecular formula C15H28N4O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-N',N'-di(propan-2-yl)ethane-1,2-diamine.
| Compound Name | N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-N',N'-di(propan-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 43552126 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-N',N'-di(propan-2-yl)ethane-1,2-diamine |
| SMILES | COc1ncnc(OC)c1CNCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C15H28N4O2/c1-11(2)19(12(3)4)8-7-16-9-13-14(20-5)17-10-18-15(13)21-6/h10-12,16H,7-9H2,1-6H3 |
| InChIKey | VSPOEUJJFPSQMZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|