C12H15BrN2O3 — CID 43553153
3-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methylamino]propanamide (PubChem CID 43553153) has the molecular formula C12H15BrN2O3 and a molecular weight of 315.17 g/mol. Its IUPAC name is 3-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methylamino]propanamide.
| Compound Name | 3-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 43553153 |
| Molecular Formula | C12H15BrN2O3 |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 3-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methylamino]propanamide |
| SMILES | NC(=O)CCNCc1cc(Br)c2c(c1)OCCO2 |
| InChI | InChI=1S/C12H15BrN2O3/c13-9-5-8(7-15-2-1-11(14)16)6-10-12(9)18-4-3-17-10/h5-6,15H,1-4,7H2,(H2,14,16) |
| InChIKey | UOCDWWJFOMLUOC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|