About 5-ethylsulfonyl-1,3-dimethylpyrazol-4-amine
5-ethylsulfonyl-1,3-dimethylpyrazol-4-amine (PubChem CID 43553926) has the molecular formula C7H13N3O2S
and a molecular weight of 203.27 g/mol. Its IUPAC name is 5-ethylsulfonyl-1,3-dimethylpyrazol-4-amine.
Molecular Properties
| Compound Name | 5-ethylsulfonyl-1,3-dimethylpyrazol-4-amine |
| PubChem CID | 43553926 |
| Molecular Formula | C7H13N3O2S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 5-ethylsulfonyl-1,3-dimethylpyrazol-4-amine |
| SMILES | CCS(=O)(=O)c1c(N)c(C)nn1C |
| InChI | InChI=1S/C7H13N3O2S/c1-4-13(11,12)7-6(8)5(2)9-10(7)3/h4,8H2,1-3H3 |
| InChIKey | CRHKWSIZWQFMAD-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-ethylsulfonyl-1,3-dimethylpyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylsulfonyl-1,3-dimethylpyrazol-4-amine?
The IUPAC name of 5-ethylsulfonyl-1,3-dimethylpyrazol-4-amine (CID 43553926) is 5-ethylsulfonyl-1,3-dimethylpyrazol-4-amine.
What is the SMILES notation for 5-ethylsulfonyl-1,3-dimethylpyrazol-4-amine?
The canonical SMILES for 5-ethylsulfonyl-1,3-dimethylpyrazol-4-amine is CCS(=O)(=O)c1c(N)c(C)nn1C.
What is the InChIKey of 5-ethylsulfonyl-1,3-dimethylpyrazol-4-amine?
The InChIKey is CRHKWSIZWQFMAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O2S/c1-4-13(11,12)7-6(8)5(2)9-10(7)3/h4,8H2,1-3H3.
What are the key properties of 5-ethylsulfonyl-1,3-dimethylpyrazol-4-amine?
5-ethylsulfonyl-1,3-dimethylpyrazol-4-amine has a molecular weight of 203.27 g/mol, XLogP of 0.10, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylsulfonyl-1,3-dimethylpyrazol-4-amine is sourced from PubChem (CID 43553926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).