About 5-N-ethyl-1,3-dimethylpyrazole-4,5-diamine
5-N-ethyl-1,3-dimethylpyrazole-4,5-diamine (PubChem CID 43554024) has the molecular formula C7H14N4
and a molecular weight of 154.22 g/mol. Its IUPAC name is 5-N-ethyl-1,3-dimethylpyrazole-4,5-diamine.
Molecular Properties
| Compound Name | 5-N-ethyl-1,3-dimethylpyrazole-4,5-diamine |
| PubChem CID | 43554024 |
| Molecular Formula | C7H14N4 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | 5-N-ethyl-1,3-dimethylpyrazole-4,5-diamine |
| SMILES | CCNc1c(N)c(C)nn1C |
| InChI | InChI=1S/C7H14N4/c1-4-9-7-6(8)5(2)10-11(7)3/h9H,4,8H2,1-3H3 |
| InChIKey | GKERKLLAMVQMOK-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-N-ethyl-1,3-dimethylpyrazole-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-ethyl-1,3-dimethylpyrazole-4,5-diamine?
The IUPAC name of 5-N-ethyl-1,3-dimethylpyrazole-4,5-diamine (CID 43554024) is 5-N-ethyl-1,3-dimethylpyrazole-4,5-diamine.
What is the SMILES notation for 5-N-ethyl-1,3-dimethylpyrazole-4,5-diamine?
The canonical SMILES for 5-N-ethyl-1,3-dimethylpyrazole-4,5-diamine is CCNc1c(N)c(C)nn1C.
What is the InChIKey of 5-N-ethyl-1,3-dimethylpyrazole-4,5-diamine?
The InChIKey is GKERKLLAMVQMOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4/c1-4-9-7-6(8)5(2)10-11(7)3/h9H,4,8H2,1-3H3.
What are the key properties of 5-N-ethyl-1,3-dimethylpyrazole-4,5-diamine?
5-N-ethyl-1,3-dimethylpyrazole-4,5-diamine has a molecular weight of 154.22 g/mol, XLogP of 0.74, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-ethyl-1,3-dimethylpyrazole-4,5-diamine is sourced from PubChem (CID 43554024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).