C11H21N5O2 — CID 43554201
N-(1,3-dimethyl-4-nitropyrazol-5-yl)-N',N'-diethylethane-1,2-diamine (PubChem CID 43554201) has the molecular formula C11H21N5O2 and a molecular weight of 255.32 g/mol. Its IUPAC name is N-(1,3-dimethyl-4-nitropyrazol-5-yl)-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-(1,3-dimethyl-4-nitropyrazol-5-yl)-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 43554201 |
| Molecular Formula | C11H21N5O2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | N-(1,3-dimethyl-4-nitropyrazol-5-yl)-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNc1c([N+](=O)[O-])c(C)nn1C |
| InChI | InChI=1S/C11H21N5O2/c1-5-15(6-2)8-7-12-11-10(16(17)18)9(3)13-14(11)4/h12H,5-8H2,1-4H3 |
| InChIKey | NTVFAZRFGIJPKH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|