About [1-(4-amino-1,3-dimethylpyrazol-5-yl)piperidin-4-yl]methanol
[1-(4-amino-1,3-dimethylpyrazol-5-yl)piperidin-4-yl]methanol (PubChem CID 43554217) has the molecular formula C11H20N4O
and a molecular weight of 224.31 g/mol. Its IUPAC name is [1-(4-amino-1,3-dimethylpyrazol-5-yl)piperidin-4-yl]methanol.
Molecular Properties
| Compound Name | [1-(4-amino-1,3-dimethylpyrazol-5-yl)piperidin-4-yl]methanol |
| PubChem CID | 43554217 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | [1-(4-amino-1,3-dimethylpyrazol-5-yl)piperidin-4-yl]methanol |
| SMILES | Cc1nn(C)c(N2CCC(CO)CC2)c1N |
| InChI | InChI=1S/C11H20N4O/c1-8-10(12)11(14(2)13-8)15-5-3-9(7-16)4-6-15/h9,16H,3-7,12H2,1-2H3 |
| InChIKey | XSBDHDCLTSLVQG-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(4-amino-1,3-dimethylpyrazol-5-yl)piperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-amino-1,3-dimethylpyrazol-5-yl)piperidin-4-yl]methanol?
The IUPAC name of [1-(4-amino-1,3-dimethylpyrazol-5-yl)piperidin-4-yl]methanol (CID 43554217) is [1-(4-amino-1,3-dimethylpyrazol-5-yl)piperidin-4-yl]methanol.
What is the SMILES notation for [1-(4-amino-1,3-dimethylpyrazol-5-yl)piperidin-4-yl]methanol?
The canonical SMILES for [1-(4-amino-1,3-dimethylpyrazol-5-yl)piperidin-4-yl]methanol is Cc1nn(C)c(N2CCC(CO)CC2)c1N.
What is the InChIKey of [1-(4-amino-1,3-dimethylpyrazol-5-yl)piperidin-4-yl]methanol?
The InChIKey is XSBDHDCLTSLVQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4O/c1-8-10(12)11(14(2)13-8)15-5-3-9(7-16)4-6-15/h9,16H,3-7,12H2,1-2H3.
What are the key properties of [1-(4-amino-1,3-dimethylpyrazol-5-yl)piperidin-4-yl]methanol?
[1-(4-amino-1,3-dimethylpyrazol-5-yl)piperidin-4-yl]methanol has a molecular weight of 224.31 g/mol, XLogP of 0.52, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-amino-1,3-dimethylpyrazol-5-yl)piperidin-4-yl]methanol is sourced from PubChem (CID 43554217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).