C12H22N4 — CID 43554231
5-N-cycloheptyl-1,3-dimethylpyrazole-4,5-diamine (PubChem CID 43554231) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is 5-N-cycloheptyl-1,3-dimethylpyrazole-4,5-diamine.
| Compound Name | 5-N-cycloheptyl-1,3-dimethylpyrazole-4,5-diamine |
|---|---|
| PubChem CID | 43554231 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 5-N-cycloheptyl-1,3-dimethylpyrazole-4,5-diamine |
| SMILES | Cc1nn(C)c(NC2CCCCCC2)c1N |
| InChI | InChI=1S/C12H22N4/c1-9-11(13)12(16(2)15-9)14-10-7-5-3-4-6-8-10/h10,14H,3-8,13H2,1-2H3 |
| InChIKey | WYGCMSMZPIPEBH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |