About 5-(benzimidazol-1-yl)-1,3-dimethylpyrazol-4-amine
5-(benzimidazol-1-yl)-1,3-dimethylpyrazol-4-amine (PubChem CID 43554355) has the molecular formula C12H13N5
and a molecular weight of 227.27 g/mol. Its IUPAC name is 5-(benzimidazol-1-yl)-1,3-dimethylpyrazol-4-amine.
Molecular Properties
| Compound Name | 5-(benzimidazol-1-yl)-1,3-dimethylpyrazol-4-amine |
| PubChem CID | 43554355 |
| Molecular Formula | C12H13N5 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 5-(benzimidazol-1-yl)-1,3-dimethylpyrazol-4-amine |
| SMILES | Cc1nn(C)c(-n2cnc3ccccc32)c1N |
| InChI | InChI=1S/C12H13N5/c1-8-11(13)12(16(2)15-8)17-7-14-9-5-3-4-6-10(9)17/h3-7H,13H2,1-2H3 |
| InChIKey | JTRPNHCOCHLANF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(benzimidazol-1-yl)-1,3-dimethylpyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(benzimidazol-1-yl)-1,3-dimethylpyrazol-4-amine?
The IUPAC name of 5-(benzimidazol-1-yl)-1,3-dimethylpyrazol-4-amine (CID 43554355) is 5-(benzimidazol-1-yl)-1,3-dimethylpyrazol-4-amine.
What is the SMILES notation for 5-(benzimidazol-1-yl)-1,3-dimethylpyrazol-4-amine?
The canonical SMILES for 5-(benzimidazol-1-yl)-1,3-dimethylpyrazol-4-amine is Cc1nn(C)c(-n2cnc3ccccc32)c1N.
What is the InChIKey of 5-(benzimidazol-1-yl)-1,3-dimethylpyrazol-4-amine?
The InChIKey is JTRPNHCOCHLANF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N5/c1-8-11(13)12(16(2)15-8)17-7-14-9-5-3-4-6-10(9)17/h3-7H,13H2,1-2H3.
What are the key properties of 5-(benzimidazol-1-yl)-1,3-dimethylpyrazol-4-amine?
5-(benzimidazol-1-yl)-1,3-dimethylpyrazol-4-amine has a molecular weight of 227.27 g/mol, XLogP of 1.65, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(benzimidazol-1-yl)-1,3-dimethylpyrazol-4-amine is sourced from PubChem (CID 43554355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).