C16H17F2NO — CID 43554911
N-[[2-(3,4-difluorophenoxy)phenyl]methyl]propan-2-amine (PubChem CID 43554911) has the molecular formula C16H17F2NO and a molecular weight of 277.31 g/mol. Its IUPAC name is N-[[2-(3,4-difluorophenoxy)phenyl]methyl]propan-2-amine.
| Compound Name | N-[[2-(3,4-difluorophenoxy)phenyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 43554911 |
| Molecular Formula | C16H17F2NO |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | N-[[2-(3,4-difluorophenoxy)phenyl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1ccccc1Oc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H17F2NO/c1-11(2)19-10-12-5-3-4-6-16(12)20-13-7-8-14(17)15(18)9-13/h3-9,11,19H,10H2,1-2H3 |
| InChIKey | KMOCZSYRKFNURO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |