About 5-bromo-N-(2,6-dimethylheptan-4-yl)-2-fluoroaniline
5-bromo-N-(2,6-dimethylheptan-4-yl)-2-fluoroaniline (PubChem CID 43555235) has the molecular formula C15H23BrFN
and a molecular weight of 316.26 g/mol. Its IUPAC name is 5-bromo-N-(2,6-dimethylheptan-4-yl)-2-fluoroaniline.
Molecular Properties
| Compound Name | 5-bromo-N-(2,6-dimethylheptan-4-yl)-2-fluoroaniline |
| PubChem CID | 43555235 |
| Molecular Formula | C15H23BrFN |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 5-bromo-N-(2,6-dimethylheptan-4-yl)-2-fluoroaniline |
| SMILES | CC(C)CC(CC(C)C)Nc1cc(Br)ccc1F |
| InChI | InChI=1S/C15H23BrFN/c1-10(2)7-13(8-11(3)4)18-15-9-12(16)5-6-14(15)17/h5-6,9-11,13,18H,7-8H2,1-4H3 |
| InChIKey | TULGFDZBNNKWFH-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-N-(2,6-dimethylheptan-4-yl)-2-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(2,6-dimethylheptan-4-yl)-2-fluoroaniline?
The IUPAC name of 5-bromo-N-(2,6-dimethylheptan-4-yl)-2-fluoroaniline (CID 43555235) is 5-bromo-N-(2,6-dimethylheptan-4-yl)-2-fluoroaniline.
What is the SMILES notation for 5-bromo-N-(2,6-dimethylheptan-4-yl)-2-fluoroaniline?
The canonical SMILES for 5-bromo-N-(2,6-dimethylheptan-4-yl)-2-fluoroaniline is CC(C)CC(CC(C)C)Nc1cc(Br)ccc1F.
What is the InChIKey of 5-bromo-N-(2,6-dimethylheptan-4-yl)-2-fluoroaniline?
The InChIKey is TULGFDZBNNKWFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23BrFN/c1-10(2)7-13(8-11(3)4)18-15-9-12(16)5-6-14(15)17/h5-6,9-11,13,18H,7-8H2,1-4H3.
What are the key properties of 5-bromo-N-(2,6-dimethylheptan-4-yl)-2-fluoroaniline?
5-bromo-N-(2,6-dimethylheptan-4-yl)-2-fluoroaniline has a molecular weight of 316.26 g/mol, XLogP of 5.46, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(2,6-dimethylheptan-4-yl)-2-fluoroaniline is sourced from PubChem (CID 43555235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).