About 3-(5-bromo-2-fluoroanilino)-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol
3-(5-bromo-2-fluoroanilino)-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol (PubChem CID 43555324) has the molecular formula C17H17BrFNO
and a molecular weight of 350.23 g/mol. Its IUPAC name is 3-(5-bromo-2-fluoroanilino)-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol.
Molecular Properties
| Compound Name | 3-(5-bromo-2-fluoroanilino)-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol |
| PubChem CID | 43555324 |
| Molecular Formula | C17H17BrFNO |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 3-(5-bromo-2-fluoroanilino)-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol |
| SMILES | Cc1ccc(O)c2c1C(C)CC2Nc1cc(Br)ccc1F |
| InChI | InChI=1S/C17H17BrFNO/c1-9-3-6-15(21)17-14(7-10(2)16(9)17)20-13-8-11(18)4-5-12(13)19/h3-6,8,10,14,20-21H,7H2,1-2H3 |
| InChIKey | QBUQQCCYORWFSZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-bromo-2-fluoroanilino)-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-bromo-2-fluoroanilino)-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol?
The IUPAC name of 3-(5-bromo-2-fluoroanilino)-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol (CID 43555324) is 3-(5-bromo-2-fluoroanilino)-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol.
What is the SMILES notation for 3-(5-bromo-2-fluoroanilino)-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol?
The canonical SMILES for 3-(5-bromo-2-fluoroanilino)-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol is Cc1ccc(O)c2c1C(C)CC2Nc1cc(Br)ccc1F.
What is the InChIKey of 3-(5-bromo-2-fluoroanilino)-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol?
The InChIKey is QBUQQCCYORWFSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17BrFNO/c1-9-3-6-15(21)17-14(7-10(2)16(9)17)20-13-8-11(18)4-5-12(13)19/h3-6,8,10,14,20-21H,7H2,1-2H3.
What are the key properties of 3-(5-bromo-2-fluoroanilino)-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol?
3-(5-bromo-2-fluoroanilino)-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol has a molecular weight of 350.23 g/mol, XLogP of 5.26, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-bromo-2-fluoroanilino)-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol is sourced from PubChem (CID 43555324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).