C4H4N6S — CID 43556072
3-(1H-1,2,4-triazol-5-yl)-1,2,4-thiadiazol-5-amine (PubChem CID 43556072) has the molecular formula C4H4N6S and a molecular weight of 168.19 g/mol. Its IUPAC name is 3-(1H-1,2,4-triazol-5-yl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-(1H-1,2,4-triazol-5-yl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 43556072 |
| Molecular Formula | C4H4N6S |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | 3-(1H-1,2,4-triazol-5-yl)-1,2,4-thiadiazol-5-amine |
| SMILES | Nc1nc(-c2ncn[nH]2)ns1 |
| InChI | InChI=1S/C4H4N6S/c5-4-8-3(10-11-4)2-6-1-7-9-2/h1H,(H2,5,8,10)(H,6,7,9) |
| InChIKey | LLIKNLXITKMJSH-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |