About 1-(4-aminopiperidin-1-yl)-2-(1,2,4-triazol-1-yl)ethanone
1-(4-aminopiperidin-1-yl)-2-(1,2,4-triazol-1-yl)ethanone (PubChem CID 43556270) has the molecular formula C9H15N5O
and a molecular weight of 209.25 g/mol. Its IUPAC name is 1-(4-aminopiperidin-1-yl)-2-(1,2,4-triazol-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(4-aminopiperidin-1-yl)-2-(1,2,4-triazol-1-yl)ethanone |
| PubChem CID | 43556270 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 1-(4-aminopiperidin-1-yl)-2-(1,2,4-triazol-1-yl)ethanone |
| SMILES | NC1CCN(C(=O)Cn2cncn2)CC1 |
| InChI | InChI=1S/C9H15N5O/c10-8-1-3-13(4-2-8)9(15)5-14-7-11-6-12-14/h6-8H,1-5,10H2 |
| InChIKey | SIVUWKXPYKRXBJ-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4-aminopiperidin-1-yl)-2-(1,2,4-triazol-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-aminopiperidin-1-yl)-2-(1,2,4-triazol-1-yl)ethanone?
The IUPAC name of 1-(4-aminopiperidin-1-yl)-2-(1,2,4-triazol-1-yl)ethanone (CID 43556270) is 1-(4-aminopiperidin-1-yl)-2-(1,2,4-triazol-1-yl)ethanone.
What is the SMILES notation for 1-(4-aminopiperidin-1-yl)-2-(1,2,4-triazol-1-yl)ethanone?
The canonical SMILES for 1-(4-aminopiperidin-1-yl)-2-(1,2,4-triazol-1-yl)ethanone is NC1CCN(C(=O)Cn2cncn2)CC1.
What is the InChIKey of 1-(4-aminopiperidin-1-yl)-2-(1,2,4-triazol-1-yl)ethanone?
The InChIKey is SIVUWKXPYKRXBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5O/c10-8-1-3-13(4-2-8)9(15)5-14-7-11-6-12-14/h6-8H,1-5,10H2.
What are the key properties of 1-(4-aminopiperidin-1-yl)-2-(1,2,4-triazol-1-yl)ethanone?
1-(4-aminopiperidin-1-yl)-2-(1,2,4-triazol-1-yl)ethanone has a molecular weight of 209.25 g/mol, XLogP of -0.77, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-aminopiperidin-1-yl)-2-(1,2,4-triazol-1-yl)ethanone is sourced from PubChem (CID 43556270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).