About 1-[(5-methyl-1,2-oxazol-3-yl)methylsulfonyl]piperidin-4-amine
1-[(5-methyl-1,2-oxazol-3-yl)methylsulfonyl]piperidin-4-amine (PubChem CID 43556289) has the molecular formula C10H17N3O3S
and a molecular weight of 259.33 g/mol. Its IUPAC name is 1-[(5-methyl-1,2-oxazol-3-yl)methylsulfonyl]piperidin-4-amine.
Molecular Properties
| Compound Name | 1-[(5-methyl-1,2-oxazol-3-yl)methylsulfonyl]piperidin-4-amine |
| PubChem CID | 43556289 |
| Molecular Formula | C10H17N3O3S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 1-[(5-methyl-1,2-oxazol-3-yl)methylsulfonyl]piperidin-4-amine |
| SMILES | Cc1cc(CS(=O)(=O)N2CCC(N)CC2)no1 |
| InChI | InChI=1S/C10H17N3O3S/c1-8-6-10(12-16-8)7-17(14,15)13-4-2-9(11)3-5-13/h6,9H,2-5,7,11H2,1H3 |
| InChIKey | BCAQPCRFLPXKCL-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(5-methyl-1,2-oxazol-3-yl)methylsulfonyl]piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-methyl-1,2-oxazol-3-yl)methylsulfonyl]piperidin-4-amine?
The IUPAC name of 1-[(5-methyl-1,2-oxazol-3-yl)methylsulfonyl]piperidin-4-amine (CID 43556289) is 1-[(5-methyl-1,2-oxazol-3-yl)methylsulfonyl]piperidin-4-amine.
What is the SMILES notation for 1-[(5-methyl-1,2-oxazol-3-yl)methylsulfonyl]piperidin-4-amine?
The canonical SMILES for 1-[(5-methyl-1,2-oxazol-3-yl)methylsulfonyl]piperidin-4-amine is Cc1cc(CS(=O)(=O)N2CCC(N)CC2)no1.
What is the InChIKey of 1-[(5-methyl-1,2-oxazol-3-yl)methylsulfonyl]piperidin-4-amine?
The InChIKey is BCAQPCRFLPXKCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O3S/c1-8-6-10(12-16-8)7-17(14,15)13-4-2-9(11)3-5-13/h6,9H,2-5,7,11H2,1H3.
What are the key properties of 1-[(5-methyl-1,2-oxazol-3-yl)methylsulfonyl]piperidin-4-amine?
1-[(5-methyl-1,2-oxazol-3-yl)methylsulfonyl]piperidin-4-amine has a molecular weight of 259.33 g/mol, XLogP of 0.24, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-methyl-1,2-oxazol-3-yl)methylsulfonyl]piperidin-4-amine is sourced from PubChem (CID 43556289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).