About 1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-4-amine
1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-4-amine (PubChem CID 43556530) has the molecular formula C12H22N4O
and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-4-amine.
Molecular Properties
| Compound Name | 1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-4-amine |
| PubChem CID | 43556530 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-4-amine |
| SMILES | CC(C)(C)c1nnc(CN2CCC(N)CC2)o1 |
| InChI | InChI=1S/C12H22N4O/c1-12(2,3)11-15-14-10(17-11)8-16-6-4-9(13)5-7-16/h9H,4-8,13H2,1-3H3 |
| InChIKey | FHCNDLOJCQPRBO-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-4-amine?
The IUPAC name of 1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-4-amine (CID 43556530) is 1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-4-amine.
What is the SMILES notation for 1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-4-amine?
The canonical SMILES for 1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-4-amine is CC(C)(C)c1nnc(CN2CCC(N)CC2)o1.
What is the InChIKey of 1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-4-amine?
The InChIKey is FHCNDLOJCQPRBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4O/c1-12(2,3)11-15-14-10(17-11)8-16-6-4-9(13)5-7-16/h9H,4-8,13H2,1-3H3.
What are the key properties of 1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-4-amine?
1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-4-amine has a molecular weight of 238.33 g/mol, XLogP of 1.29, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-4-amine is sourced from PubChem (CID 43556530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).