About 1-(1,2,4-oxadiazol-5-ylmethyl)piperidin-4-amine
1-(1,2,4-oxadiazol-5-ylmethyl)piperidin-4-amine (PubChem CID 43556664) has the molecular formula C8H14N4O
and a molecular weight of 182.23 g/mol. Its IUPAC name is 1-(1,2,4-oxadiazol-5-ylmethyl)piperidin-4-amine.
Molecular Properties
| Compound Name | 1-(1,2,4-oxadiazol-5-ylmethyl)piperidin-4-amine |
| PubChem CID | 43556664 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 1-(1,2,4-oxadiazol-5-ylmethyl)piperidin-4-amine |
| SMILES | NC1CCN(Cc2ncno2)CC1 |
| InChI | InChI=1S/C8H14N4O/c9-7-1-3-12(4-2-7)5-8-10-6-11-13-8/h6-7H,1-5,9H2 |
| InChIKey | OUINVGABAIEZLF-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(1,2,4-oxadiazol-5-ylmethyl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2,4-oxadiazol-5-ylmethyl)piperidin-4-amine?
The IUPAC name of 1-(1,2,4-oxadiazol-5-ylmethyl)piperidin-4-amine (CID 43556664) is 1-(1,2,4-oxadiazol-5-ylmethyl)piperidin-4-amine.
What is the SMILES notation for 1-(1,2,4-oxadiazol-5-ylmethyl)piperidin-4-amine?
The canonical SMILES for 1-(1,2,4-oxadiazol-5-ylmethyl)piperidin-4-amine is NC1CCN(Cc2ncno2)CC1.
What is the InChIKey of 1-(1,2,4-oxadiazol-5-ylmethyl)piperidin-4-amine?
The InChIKey is OUINVGABAIEZLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O/c9-7-1-3-12(4-2-7)5-8-10-6-11-13-8/h6-7H,1-5,9H2.
What are the key properties of 1-(1,2,4-oxadiazol-5-ylmethyl)piperidin-4-amine?
1-(1,2,4-oxadiazol-5-ylmethyl)piperidin-4-amine has a molecular weight of 182.23 g/mol, XLogP of -0.01, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2,4-oxadiazol-5-ylmethyl)piperidin-4-amine is sourced from PubChem (CID 43556664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).