About 3-(4-butan-2-yl-2,5-dioxoimidazolidin-1-yl)benzonitrile
3-(4-butan-2-yl-2,5-dioxoimidazolidin-1-yl)benzonitrile (PubChem CID 43558115) has the molecular formula C14H15N3O2
and a molecular weight of 257.29 g/mol. Its IUPAC name is 3-(4-butan-2-yl-2,5-dioxoimidazolidin-1-yl)benzonitrile.
Molecular Properties
| Compound Name | 3-(4-butan-2-yl-2,5-dioxoimidazolidin-1-yl)benzonitrile |
| PubChem CID | 43558115 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 3-(4-butan-2-yl-2,5-dioxoimidazolidin-1-yl)benzonitrile |
| SMILES | CCC(C)C1NC(=O)N(c2cccc(C#N)c2)C1=O |
| InChI | InChI=1S/C14H15N3O2/c1-3-9(2)12-13(18)17(14(19)16-12)11-6-4-5-10(7-11)8-15/h4-7,9,12H,3H2,1-2H3,(H,16,19) |
| InChIKey | BQWUYAAGHMNEAJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-butan-2-yl-2,5-dioxoimidazolidin-1-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-butan-2-yl-2,5-dioxoimidazolidin-1-yl)benzonitrile?
The IUPAC name of 3-(4-butan-2-yl-2,5-dioxoimidazolidin-1-yl)benzonitrile (CID 43558115) is 3-(4-butan-2-yl-2,5-dioxoimidazolidin-1-yl)benzonitrile.
What is the SMILES notation for 3-(4-butan-2-yl-2,5-dioxoimidazolidin-1-yl)benzonitrile?
The canonical SMILES for 3-(4-butan-2-yl-2,5-dioxoimidazolidin-1-yl)benzonitrile is CCC(C)C1NC(=O)N(c2cccc(C#N)c2)C1=O.
What is the InChIKey of 3-(4-butan-2-yl-2,5-dioxoimidazolidin-1-yl)benzonitrile?
The InChIKey is BQWUYAAGHMNEAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O2/c1-3-9(2)12-13(18)17(14(19)16-12)11-6-4-5-10(7-11)8-15/h4-7,9,12H,3H2,1-2H3,(H,16,19).
What are the key properties of 3-(4-butan-2-yl-2,5-dioxoimidazolidin-1-yl)benzonitrile?
3-(4-butan-2-yl-2,5-dioxoimidazolidin-1-yl)benzonitrile has a molecular weight of 257.29 g/mol, XLogP of 2.03, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-butan-2-yl-2,5-dioxoimidazolidin-1-yl)benzonitrile is sourced from PubChem (CID 43558115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).