6-(1,3-thiazol-2-ylcarbamoyl)pyridine-2-carboxylic acid

C10H7N3O3S — CID 43558260

IUPAC6-(1,3-thiazol-2-ylcarbamoyl)pyridine-2-carboxylic acid
SMILESO=C(O)c1cccc(C(=O)Nc2nccs2)n1
InChIInChI=1S/C10H7N3O3S/c14-8(13-10-11-4-5-17-10)6-2-1-3-7(12-6)9(15)16/h1-5H,(H,15,16)(H,11,13,14)
InChIKeyMFXBYAULDBSVLT-UHFFFAOYSA-N
MW249.25 g/mol
LogP1.49
Rot. Bonds3

About 6-(1,3-thiazol-2-ylcarbamoyl)pyridine-2-carboxylic acid

6-(1,3-thiazol-2-ylcarbamoyl)pyridine-2-carboxylic acid (PubChem CID 43558260) has the molecular formula C10H7N3O3S and a molecular weight of 249.25 g/mol. Its IUPAC name is 6-(1,3-thiazol-2-ylcarbamoyl)pyridine-2-carboxylic acid.

Molecular Properties

Compound Name6-(1,3-thiazol-2-ylcarbamoyl)pyridine-2-carboxylic acid
PubChem CID43558260
Molecular FormulaC10H7N3O3S
Molecular Weight249.25 g/mol
Exact Mass249.02
IUPAC Name6-(1,3-thiazol-2-ylcarbamoyl)pyridine-2-carboxylic acid
SMILESO=C(O)c1cccc(C(=O)Nc2nccs2)n1
InChIInChI=1S/C10H7N3O3S/c14-8(13-10-11-4-5-17-10)6-2-1-3-7(12-6)9(15)16/h1-5H,(H,15,16)(H,11,13,14)
InChIKeyMFXBYAULDBSVLT-UHFFFAOYSA-N
XLogP1.49
TPSA92.18 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.25
LogP ≤ 51.49
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 6-(1,3-thiazol-2-ylcarbamoyl)pyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(1,3-thiazol-2-ylcarbamoyl)pyridine-2-carboxylic acid?
The IUPAC name of 6-(1,3-thiazol-2-ylcarbamoyl)pyridine-2-carboxylic acid (CID 43558260) is 6-(1,3-thiazol-2-ylcarbamoyl)pyridine-2-carboxylic acid.
What is the SMILES notation for 6-(1,3-thiazol-2-ylcarbamoyl)pyridine-2-carboxylic acid?
The canonical SMILES for 6-(1,3-thiazol-2-ylcarbamoyl)pyridine-2-carboxylic acid is O=C(O)c1cccc(C(=O)Nc2nccs2)n1.
What is the InChIKey of 6-(1,3-thiazol-2-ylcarbamoyl)pyridine-2-carboxylic acid?
The InChIKey is MFXBYAULDBSVLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3O3S/c14-8(13-10-11-4-5-17-10)6-2-1-3-7(12-6)9(15)16/h1-5H,(H,15,16)(H,11,13,14).
What are the key properties of 6-(1,3-thiazol-2-ylcarbamoyl)pyridine-2-carboxylic acid?
6-(1,3-thiazol-2-ylcarbamoyl)pyridine-2-carboxylic acid has a molecular weight of 249.25 g/mol, XLogP of 1.49, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,3-thiazol-2-ylcarbamoyl)pyridine-2-carboxylic acid is sourced from PubChem (CID 43558260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).