About 4-(5-methyl-1,3-thiazol-2-yl)-2,3-dihydrothiochromen-4-amine
4-(5-methyl-1,3-thiazol-2-yl)-2,3-dihydrothiochromen-4-amine (PubChem CID 43558980) has the molecular formula C13H14N2S2
and a molecular weight of 262.40 g/mol. Its IUPAC name is 4-(5-methyl-1,3-thiazol-2-yl)-2,3-dihydrothiochromen-4-amine.
Molecular Properties
| Compound Name | 4-(5-methyl-1,3-thiazol-2-yl)-2,3-dihydrothiochromen-4-amine |
| PubChem CID | 43558980 |
| Molecular Formula | C13H14N2S2 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 4-(5-methyl-1,3-thiazol-2-yl)-2,3-dihydrothiochromen-4-amine |
| SMILES | Cc1cnc(C2(N)CCSc3ccccc32)s1 |
| InChI | InChI=1S/C13H14N2S2/c1-9-8-15-12(17-9)13(14)6-7-16-11-5-3-2-4-10(11)13/h2-5,8H,6-7,14H2,1H3 |
| InChIKey | BNEILAVJZRUENU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(5-methyl-1,3-thiazol-2-yl)-2,3-dihydrothiochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-methyl-1,3-thiazol-2-yl)-2,3-dihydrothiochromen-4-amine?
The IUPAC name of 4-(5-methyl-1,3-thiazol-2-yl)-2,3-dihydrothiochromen-4-amine (CID 43558980) is 4-(5-methyl-1,3-thiazol-2-yl)-2,3-dihydrothiochromen-4-amine.
What is the SMILES notation for 4-(5-methyl-1,3-thiazol-2-yl)-2,3-dihydrothiochromen-4-amine?
The canonical SMILES for 4-(5-methyl-1,3-thiazol-2-yl)-2,3-dihydrothiochromen-4-amine is Cc1cnc(C2(N)CCSc3ccccc32)s1.
What is the InChIKey of 4-(5-methyl-1,3-thiazol-2-yl)-2,3-dihydrothiochromen-4-amine?
The InChIKey is BNEILAVJZRUENU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2S2/c1-9-8-15-12(17-9)13(14)6-7-16-11-5-3-2-4-10(11)13/h2-5,8H,6-7,14H2,1H3.
What are the key properties of 4-(5-methyl-1,3-thiazol-2-yl)-2,3-dihydrothiochromen-4-amine?
4-(5-methyl-1,3-thiazol-2-yl)-2,3-dihydrothiochromen-4-amine has a molecular weight of 262.40 g/mol, XLogP of 3.15, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-methyl-1,3-thiazol-2-yl)-2,3-dihydrothiochromen-4-amine is sourced from PubChem (CID 43558980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).