C11H11N3OS — CID 43559202
4-(1,2,4-oxadiazol-3-yl)-2,3-dihydrothiochromen-4-amine (PubChem CID 43559202) has the molecular formula C11H11N3OS and a molecular weight of 233.30 g/mol. Its IUPAC name is 4-(1,2,4-oxadiazol-3-yl)-2,3-dihydrothiochromen-4-amine.
| Compound Name | 4-(1,2,4-oxadiazol-3-yl)-2,3-dihydrothiochromen-4-amine |
|---|---|
| PubChem CID | 43559202 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 4-(1,2,4-oxadiazol-3-yl)-2,3-dihydrothiochromen-4-amine |
| SMILES | NC1(c2ncon2)CCSc2ccccc21 |
| InChI | InChI=1S/C11H11N3OS/c12-11(10-13-7-15-14-10)5-6-16-9-4-2-1-3-8(9)11/h1-4,7H,5-6,12H2 |
| InChIKey | SKFFGCVKNJLXCB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |