About (5-ethyl-1,2,4-oxadiazol-3-yl)-[4-(trifluoromethylsulfanyl)phenyl]methanamine
(5-ethyl-1,2,4-oxadiazol-3-yl)-[4-(trifluoromethylsulfanyl)phenyl]methanamine (PubChem CID 43559370) has the molecular formula C12H12F3N3OS
and a molecular weight of 303.31 g/mol. Its IUPAC name is (5-ethyl-1,2,4-oxadiazol-3-yl)-[4-(trifluoromethylsulfanyl)phenyl]methanamine.
Molecular Properties
| Compound Name | (5-ethyl-1,2,4-oxadiazol-3-yl)-[4-(trifluoromethylsulfanyl)phenyl]methanamine |
| PubChem CID | 43559370 |
| Molecular Formula | C12H12F3N3OS |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | (5-ethyl-1,2,4-oxadiazol-3-yl)-[4-(trifluoromethylsulfanyl)phenyl]methanamine |
| SMILES | CCc1nc(C(N)c2ccc(SC(F)(F)F)cc2)no1 |
| InChI | InChI=1S/C12H12F3N3OS/c1-2-9-17-11(18-19-9)10(16)7-3-5-8(6-4-7)20-12(13,14)15/h3-6,10H,2,16H2,1H3 |
| InChIKey | FAHPCZVOOGOTGY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-ethyl-1,2,4-oxadiazol-3-yl)-[4-(trifluoromethylsulfanyl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-ethyl-1,2,4-oxadiazol-3-yl)-[4-(trifluoromethylsulfanyl)phenyl]methanamine?
The IUPAC name of (5-ethyl-1,2,4-oxadiazol-3-yl)-[4-(trifluoromethylsulfanyl)phenyl]methanamine (CID 43559370) is (5-ethyl-1,2,4-oxadiazol-3-yl)-[4-(trifluoromethylsulfanyl)phenyl]methanamine.
What is the SMILES notation for (5-ethyl-1,2,4-oxadiazol-3-yl)-[4-(trifluoromethylsulfanyl)phenyl]methanamine?
The canonical SMILES for (5-ethyl-1,2,4-oxadiazol-3-yl)-[4-(trifluoromethylsulfanyl)phenyl]methanamine is CCc1nc(C(N)c2ccc(SC(F)(F)F)cc2)no1.
What is the InChIKey of (5-ethyl-1,2,4-oxadiazol-3-yl)-[4-(trifluoromethylsulfanyl)phenyl]methanamine?
The InChIKey is FAHPCZVOOGOTGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F3N3OS/c1-2-9-17-11(18-19-9)10(16)7-3-5-8(6-4-7)20-12(13,14)15/h3-6,10H,2,16H2,1H3.
What are the key properties of (5-ethyl-1,2,4-oxadiazol-3-yl)-[4-(trifluoromethylsulfanyl)phenyl]methanamine?
(5-ethyl-1,2,4-oxadiazol-3-yl)-[4-(trifluoromethylsulfanyl)phenyl]methanamine has a molecular weight of 303.31 g/mol, XLogP of 3.29, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethyl-1,2,4-oxadiazol-3-yl)-[4-(trifluoromethylsulfanyl)phenyl]methanamine is sourced from PubChem (CID 43559370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).