About 2-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-5-methylhexan-2-amine
2-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-5-methylhexan-2-amine (PubChem CID 43559704) has the molecular formula C12H21N3O
and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-5-methylhexan-2-amine.
Molecular Properties
| Compound Name | 2-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-5-methylhexan-2-amine |
| PubChem CID | 43559704 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 2-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-5-methylhexan-2-amine |
| SMILES | CC(C)CCC(C)(N)c1noc(C2CC2)n1 |
| InChI | InChI=1S/C12H21N3O/c1-8(2)6-7-12(3,13)11-14-10(16-15-11)9-4-5-9/h8-9H,4-7,13H2,1-3H3 |
| InChIKey | ILTFSZMBYPAORU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-5-methylhexan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-5-methylhexan-2-amine?
The IUPAC name of 2-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-5-methylhexan-2-amine (CID 43559704) is 2-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-5-methylhexan-2-amine.
What is the SMILES notation for 2-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-5-methylhexan-2-amine?
The canonical SMILES for 2-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-5-methylhexan-2-amine is CC(C)CCC(C)(N)c1noc(C2CC2)n1.
What is the InChIKey of 2-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-5-methylhexan-2-amine?
The InChIKey is ILTFSZMBYPAORU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O/c1-8(2)6-7-12(3,13)11-14-10(16-15-11)9-4-5-9/h8-9H,4-7,13H2,1-3H3.
What are the key properties of 2-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-5-methylhexan-2-amine?
2-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-5-methylhexan-2-amine has a molecular weight of 223.32 g/mol, XLogP of 2.56, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-5-methylhexan-2-amine is sourced from PubChem (CID 43559704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).