About 4-bromo-N-(cyclopropylmethyl)-2,6-dimethylaniline
4-bromo-N-(cyclopropylmethyl)-2,6-dimethylaniline (PubChem CID 43560330) has the molecular formula C12H16BrN
and a molecular weight of 254.17 g/mol. Its IUPAC name is 4-bromo-N-(cyclopropylmethyl)-2,6-dimethylaniline.
Molecular Properties
| Compound Name | 4-bromo-N-(cyclopropylmethyl)-2,6-dimethylaniline |
| PubChem CID | 43560330 |
| Molecular Formula | C12H16BrN |
| Molecular Weight | 254.17 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 4-bromo-N-(cyclopropylmethyl)-2,6-dimethylaniline |
| SMILES | Cc1cc(Br)cc(C)c1NCC1CC1 |
| InChI | InChI=1S/C12H16BrN/c1-8-5-11(13)6-9(2)12(8)14-7-10-3-4-10/h5-6,10,14H,3-4,7H2,1-2H3 |
| InChIKey | UDVREVCMPFPYKI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.17 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-N-(cyclopropylmethyl)-2,6-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-(cyclopropylmethyl)-2,6-dimethylaniline?
The IUPAC name of 4-bromo-N-(cyclopropylmethyl)-2,6-dimethylaniline (CID 43560330) is 4-bromo-N-(cyclopropylmethyl)-2,6-dimethylaniline.
What is the SMILES notation for 4-bromo-N-(cyclopropylmethyl)-2,6-dimethylaniline?
The canonical SMILES for 4-bromo-N-(cyclopropylmethyl)-2,6-dimethylaniline is Cc1cc(Br)cc(C)c1NCC1CC1.
What is the InChIKey of 4-bromo-N-(cyclopropylmethyl)-2,6-dimethylaniline?
The InChIKey is UDVREVCMPFPYKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16BrN/c1-8-5-11(13)6-9(2)12(8)14-7-10-3-4-10/h5-6,10,14H,3-4,7H2,1-2H3.
What are the key properties of 4-bromo-N-(cyclopropylmethyl)-2,6-dimethylaniline?
4-bromo-N-(cyclopropylmethyl)-2,6-dimethylaniline has a molecular weight of 254.17 g/mol, XLogP of 3.89, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-(cyclopropylmethyl)-2,6-dimethylaniline is sourced from PubChem (CID 43560330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).