C15H10BrFN2O — CID 43560892
4-(3-bromophenyl)-3-(2-fluorophenyl)-1,2-oxazol-5-amine (PubChem CID 43560892) has the molecular formula C15H10BrFN2O and a molecular weight of 333.16 g/mol. Its IUPAC name is 4-(3-bromophenyl)-3-(2-fluorophenyl)-1,2-oxazol-5-amine.
| Compound Name | 4-(3-bromophenyl)-3-(2-fluorophenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 43560892 |
| Molecular Formula | C15H10BrFN2O |
| Molecular Weight | 333.16 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | 4-(3-bromophenyl)-3-(2-fluorophenyl)-1,2-oxazol-5-amine |
| SMILES | Nc1onc(-c2ccccc2F)c1-c1cccc(Br)c1 |
| InChI | InChI=1S/C15H10BrFN2O/c16-10-5-3-4-9(8-10)13-14(19-20-15(13)18)11-6-1-2-7-12(11)17/h1-8H,18H2 |
| InChIKey | CLXATXAASWPQOG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.16 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |