About 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-2-ethylmorpholine
4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-2-ethylmorpholine (PubChem CID 43562749) has the molecular formula C9H13ClN2O3S2
and a molecular weight of 296.80 g/mol. Its IUPAC name is 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-2-ethylmorpholine.
Molecular Properties
| Compound Name | 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-2-ethylmorpholine |
| PubChem CID | 43562749 |
| Molecular Formula | C9H13ClN2O3S2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-2-ethylmorpholine |
| SMILES | CCC1CN(S(=O)(=O)c2cnc(Cl)s2)CCO1 |
| InChI | InChI=1S/C9H13ClN2O3S2/c1-2-7-6-12(3-4-15-7)17(13,14)8-5-11-9(10)16-8/h5,7H,2-4,6H2,1H3 |
| InChIKey | CKOGVNNEWHNVOR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-2-ethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-2-ethylmorpholine?
The IUPAC name of 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-2-ethylmorpholine (CID 43562749) is 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-2-ethylmorpholine.
What is the SMILES notation for 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-2-ethylmorpholine?
The canonical SMILES for 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-2-ethylmorpholine is CCC1CN(S(=O)(=O)c2cnc(Cl)s2)CCO1.
What is the InChIKey of 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-2-ethylmorpholine?
The InChIKey is CKOGVNNEWHNVOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClN2O3S2/c1-2-7-6-12(3-4-15-7)17(13,14)8-5-11-9(10)16-8/h5,7H,2-4,6H2,1H3.
What are the key properties of 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-2-ethylmorpholine?
4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-2-ethylmorpholine has a molecular weight of 296.80 g/mol, XLogP of 1.60, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-2-ethylmorpholine is sourced from PubChem (CID 43562749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).