C15H19N3 — CID 43563493
2-(1-aminoethyl)-N-methyl-N-(pyridin-3-ylmethyl)aniline (PubChem CID 43563493) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is 2-(1-aminoethyl)-N-methyl-N-(pyridin-3-ylmethyl)aniline.
| Compound Name | 2-(1-aminoethyl)-N-methyl-N-(pyridin-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 43563493 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 2-(1-aminoethyl)-N-methyl-N-(pyridin-3-ylmethyl)aniline |
| SMILES | CC(N)c1ccccc1N(C)Cc1cccnc1 |
| InChI | InChI=1S/C15H19N3/c1-12(16)14-7-3-4-8-15(14)18(2)11-13-6-5-9-17-10-13/h3-10,12H,11,16H2,1-2H3 |
| InChIKey | RPXCIJDREGUOQP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |