C13H16N4O — CID 43565126
1,3-dimethyl-5-[methyl(pyridin-2-ylmethyl)amino]pyrazole-4-carbaldehyde (PubChem CID 43565126) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 1,3-dimethyl-5-[methyl(pyridin-2-ylmethyl)amino]pyrazole-4-carbaldehyde.
| Compound Name | 1,3-dimethyl-5-[methyl(pyridin-2-ylmethyl)amino]pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 43565126 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 1,3-dimethyl-5-[methyl(pyridin-2-ylmethyl)amino]pyrazole-4-carbaldehyde |
| SMILES | Cc1nn(C)c(N(C)Cc2ccccn2)c1C=O |
| InChI | InChI=1S/C13H16N4O/c1-10-12(9-18)13(17(3)15-10)16(2)8-11-6-4-5-7-14-11/h4-7,9H,8H2,1-3H3 |
| InChIKey | JOHPUPFUCUMSJQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|