C10H14N2O2 — CID 43565544
3,5-dimethyl-1-(2-methylprop-2-enyl)pyrazole-4-carboxylic acid (PubChem CID 43565544) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 3,5-dimethyl-1-(2-methylprop-2-enyl)pyrazole-4-carboxylic acid.
| Compound Name | 3,5-dimethyl-1-(2-methylprop-2-enyl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 43565544 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 3,5-dimethyl-1-(2-methylprop-2-enyl)pyrazole-4-carboxylic acid |
| SMILES | C=C(C)Cn1nc(C)c(C(=O)O)c1C |
| InChI | InChI=1S/C10H14N2O2/c1-6(2)5-12-8(4)9(10(13)14)7(3)11-12/h1,5H2,2-4H3,(H,13,14) |
| InChIKey | RVNFHKRDELRSBU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|