C12H8Cl2N2O3 — CID 43566444
2-amino-5-[(3,5-dichloro-2-pyridinyl)oxy]benzoic acid (PubChem CID 43566444) has the molecular formula C12H8Cl2N2O3 and a molecular weight of 299.11 g/mol. Its IUPAC name is 2-amino-5-[(3,5-dichloro-2-pyridinyl)oxy]benzoic acid.
| Compound Name | 2-amino-5-[(3,5-dichloro-2-pyridinyl)oxy]benzoic acid |
|---|---|
| PubChem CID | 43566444 |
| Molecular Formula | C12H8Cl2N2O3 |
| Molecular Weight | 299.11 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 2-amino-5-[(3,5-dichloro-2-pyridinyl)oxy]benzoic acid |
| SMILES | Nc1ccc(Oc2ncc(Cl)cc2Cl)cc1C(=O)O |
| InChI | InChI=1S/C12H8Cl2N2O3/c13-6-3-9(14)11(16-5-6)19-7-1-2-10(15)8(4-7)12(17)18/h1-5H,15H2,(H,17,18) |
| InChIKey | PYYRXWQDRPZJGB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.11 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|