C11H17N3O4S — CID 43566769
2-[(4-amino-2-methoxyphenyl)sulfonylamino]-N-ethylacetamide (PubChem CID 43566769) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is 2-[(4-amino-2-methoxyphenyl)sulfonylamino]-N-ethylacetamide.
| Compound Name | 2-[(4-amino-2-methoxyphenyl)sulfonylamino]-N-ethylacetamide |
|---|---|
| PubChem CID | 43566769 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-[(4-amino-2-methoxyphenyl)sulfonylamino]-N-ethylacetamide |
| SMILES | CCNC(=O)CNS(=O)(=O)c1ccc(N)cc1OC |
| InChI | InChI=1S/C11H17N3O4S/c1-3-13-11(15)7-14-19(16,17)10-5-4-8(12)6-9(10)18-2/h4-6,14H,3,7,12H2,1-2H3,(H,13,15) |
| InChIKey | VUVGRZKOZMSMAF-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|