C10H19BrN2O2 — CID 43567046
2-bromo-3-methyl-N-[2-oxo-2-(propylamino)ethyl]butanamide (PubChem CID 43567046) has the molecular formula C10H19BrN2O2 and a molecular weight of 279.18 g/mol. Its IUPAC name is 2-bromo-3-methyl-N-[2-oxo-2-(propylamino)ethyl]butanamide.
| Compound Name | 2-bromo-3-methyl-N-[2-oxo-2-(propylamino)ethyl]butanamide |
|---|---|
| PubChem CID | 43567046 |
| Molecular Formula | C10H19BrN2O2 |
| Molecular Weight | 279.18 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 2-bromo-3-methyl-N-[2-oxo-2-(propylamino)ethyl]butanamide |
| SMILES | CCCNC(=O)CNC(=O)C(Br)C(C)C |
| InChI | InChI=1S/C10H19BrN2O2/c1-4-5-12-8(14)6-13-10(15)9(11)7(2)3/h7,9H,4-6H2,1-3H3,(H,12,14)(H,13,15) |
| InChIKey | FTQZFPGZMYLQOH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.18 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|