About 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N-ethylacetamide
2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N-ethylacetamide (PubChem CID 43567062) has the molecular formula C7H10ClN3O3S2
and a molecular weight of 283.76 g/mol. Its IUPAC name is 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N-ethylacetamide.
Molecular Properties
| Compound Name | 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N-ethylacetamide |
| PubChem CID | 43567062 |
| Molecular Formula | C7H10ClN3O3S2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N-ethylacetamide |
| SMILES | CCNC(=O)CNS(=O)(=O)c1cnc(Cl)s1 |
| InChI | InChI=1S/C7H10ClN3O3S2/c1-2-9-5(12)3-11-16(13,14)6-4-10-7(8)15-6/h4,11H,2-3H2,1H3,(H,9,12) |
| InChIKey | OAGCXXQTIKRWLE-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N-ethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N-ethylacetamide?
The IUPAC name of 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N-ethylacetamide (CID 43567062) is 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N-ethylacetamide.
What is the SMILES notation for 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N-ethylacetamide?
The canonical SMILES for 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N-ethylacetamide is CCNC(=O)CNS(=O)(=O)c1cnc(Cl)s1.
What is the InChIKey of 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N-ethylacetamide?
The InChIKey is OAGCXXQTIKRWLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClN3O3S2/c1-2-9-5(12)3-11-16(13,14)6-4-10-7(8)15-6/h4,11H,2-3H2,1H3,(H,9,12).
What are the key properties of 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N-ethylacetamide?
2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N-ethylacetamide has a molecular weight of 283.76 g/mol, XLogP of 0.21, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N-ethylacetamide is sourced from PubChem (CID 43567062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).