C12H16N4O — CID 43568877
4-N-(1-cyclopropylethyl)-4-N-methyl-2,1,3-benzoxadiazole-4,7-diamine (PubChem CID 43568877) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is 4-N-(1-cyclopropylethyl)-4-N-methyl-2,1,3-benzoxadiazole-4,7-diamine.
| Compound Name | 4-N-(1-cyclopropylethyl)-4-N-methyl-2,1,3-benzoxadiazole-4,7-diamine |
|---|---|
| PubChem CID | 43568877 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 4-N-(1-cyclopropylethyl)-4-N-methyl-2,1,3-benzoxadiazole-4,7-diamine |
| SMILES | CC(C1CC1)N(C)c1ccc(N)c2nonc12 |
| InChI | InChI=1S/C12H16N4O/c1-7(8-3-4-8)16(2)10-6-5-9(13)11-12(10)15-17-14-11/h5-8H,3-4,13H2,1-2H3 |
| InChIKey | DWOGUSSAOASSMM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|