N-(1-cyclopropylethyl)-N-methylsulfamoyl chloride

C6H12ClNO2S — CID 43569022

IUPACN-(1-cyclopropylethyl)-N-methylsulfamoyl chloride
SMILESCC(C1CC1)N(C)S(=O)(=O)Cl
InChIInChI=1S/C6H12ClNO2S/c1-5(6-3-4-6)8(2)11(7,9)10/h5-6H,3-4H2,1-2H3
InChIKeyHBWYFEPLSSZWKL-UHFFFAOYSA-N
MW197.69 g/mol
LogP1.20
Rot. Bonds3

About N-(1-cyclopropylethyl)-N-methylsulfamoyl chloride

N-(1-cyclopropylethyl)-N-methylsulfamoyl chloride (PubChem CID 43569022) has the molecular formula C6H12ClNO2S and a molecular weight of 197.69 g/mol. Its IUPAC name is N-(1-cyclopropylethyl)-N-methylsulfamoyl chloride.

Molecular Properties

Compound NameN-(1-cyclopropylethyl)-N-methylsulfamoyl chloride
PubChem CID43569022
Molecular FormulaC6H12ClNO2S
Molecular Weight197.69 g/mol
Exact Mass197.03
IUPAC NameN-(1-cyclopropylethyl)-N-methylsulfamoyl chloride
SMILESCC(C1CC1)N(C)S(=O)(=O)Cl
InChIInChI=1S/C6H12ClNO2S/c1-5(6-3-4-6)8(2)11(7,9)10/h5-6H,3-4H2,1-2H3
InChIKeyHBWYFEPLSSZWKL-UHFFFAOYSA-N
XLogP1.20
TPSA37.38 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.69
LogP ≤ 51.20
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze N-(1-cyclopropylethyl)-N-methylsulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(1-cyclopropylethyl)-N-methylsulfamoyl chloride?
The IUPAC name of N-(1-cyclopropylethyl)-N-methylsulfamoyl chloride (CID 43569022) is N-(1-cyclopropylethyl)-N-methylsulfamoyl chloride.
What is the SMILES notation for N-(1-cyclopropylethyl)-N-methylsulfamoyl chloride?
The canonical SMILES for N-(1-cyclopropylethyl)-N-methylsulfamoyl chloride is CC(C1CC1)N(C)S(=O)(=O)Cl.
What is the InChIKey of N-(1-cyclopropylethyl)-N-methylsulfamoyl chloride?
The InChIKey is HBWYFEPLSSZWKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12ClNO2S/c1-5(6-3-4-6)8(2)11(7,9)10/h5-6H,3-4H2,1-2H3.
What are the key properties of N-(1-cyclopropylethyl)-N-methylsulfamoyl chloride?
N-(1-cyclopropylethyl)-N-methylsulfamoyl chloride has a molecular weight of 197.69 g/mol, XLogP of 1.20, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyclopropylethyl)-N-methylsulfamoyl chloride is sourced from PubChem (CID 43569022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).