About N'-(1-cyclopropylethyl)-N,N'-dimethylethane-1,2-diamine
N'-(1-cyclopropylethyl)-N,N'-dimethylethane-1,2-diamine (PubChem CID 43569267) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is N'-(1-cyclopropylethyl)-N,N'-dimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(1-cyclopropylethyl)-N,N'-dimethylethane-1,2-diamine |
| PubChem CID | 43569267 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | N'-(1-cyclopropylethyl)-N,N'-dimethylethane-1,2-diamine |
| SMILES | CNCCN(C)C(C)C1CC1 |
| InChI | InChI=1S/C9H20N2/c1-8(9-4-5-9)11(3)7-6-10-2/h8-10H,4-7H2,1-3H3 |
| InChIKey | VTASEXFSLVVQJM-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N'-(1-cyclopropylethyl)-N,N'-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1-cyclopropylethyl)-N,N'-dimethylethane-1,2-diamine?
The IUPAC name of N'-(1-cyclopropylethyl)-N,N'-dimethylethane-1,2-diamine (CID 43569267) is N'-(1-cyclopropylethyl)-N,N'-dimethylethane-1,2-diamine.
What is the SMILES notation for N'-(1-cyclopropylethyl)-N,N'-dimethylethane-1,2-diamine?
The canonical SMILES for N'-(1-cyclopropylethyl)-N,N'-dimethylethane-1,2-diamine is CNCCN(C)C(C)C1CC1.
What is the InChIKey of N'-(1-cyclopropylethyl)-N,N'-dimethylethane-1,2-diamine?
The InChIKey is VTASEXFSLVVQJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2/c1-8(9-4-5-9)11(3)7-6-10-2/h8-10H,4-7H2,1-3H3.
What are the key properties of N'-(1-cyclopropylethyl)-N,N'-dimethylethane-1,2-diamine?
N'-(1-cyclopropylethyl)-N,N'-dimethylethane-1,2-diamine has a molecular weight of 156.27 g/mol, XLogP of 0.94, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1-cyclopropylethyl)-N,N'-dimethylethane-1,2-diamine is sourced from PubChem (CID 43569267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).