C16H28N2O — CID 43570790
1-(2-ethoxyphenyl)-N-methyl-N-pentan-3-ylethane-1,2-diamine (PubChem CID 43570790) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-N-methyl-N-pentan-3-ylethane-1,2-diamine.
| Compound Name | 1-(2-ethoxyphenyl)-N-methyl-N-pentan-3-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 43570790 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | 1-(2-ethoxyphenyl)-N-methyl-N-pentan-3-ylethane-1,2-diamine |
| SMILES | CCOc1ccccc1C(CN)N(C)C(CC)CC |
| InChI | InChI=1S/C16H28N2O/c1-5-13(6-2)18(4)15(12-17)14-10-8-9-11-16(14)19-7-3/h8-11,13,15H,5-7,12,17H2,1-4H3 |
| InChIKey | GLPRADLTTMGWMW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |