C10H21N3O2 — CID 43571597
N-(2-aminoethyl)-N'-methyl-N'-pentan-2-yloxamide (PubChem CID 43571597) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-methyl-N'-pentan-2-yloxamide.
| Compound Name | N-(2-aminoethyl)-N'-methyl-N'-pentan-2-yloxamide |
|---|---|
| PubChem CID | 43571597 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | N-(2-aminoethyl)-N'-methyl-N'-pentan-2-yloxamide |
| SMILES | CCCC(C)N(C)C(=O)C(=O)NCCN |
| InChI | InChI=1S/C10H21N3O2/c1-4-5-8(2)13(3)10(15)9(14)12-7-6-11/h8H,4-7,11H2,1-3H3,(H,12,14) |
| InChIKey | YNOXDYSQZSFHPM-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|