C10H17N5O2 — CID 43572615
N-(2-amino-2-oxoethyl)-2-(4-aminopyrazol-1-yl)-N-propan-2-ylacetamide (PubChem CID 43572615) has the molecular formula C10H17N5O2 and a molecular weight of 239.28 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-2-(4-aminopyrazol-1-yl)-N-propan-2-ylacetamide.
| Compound Name | N-(2-amino-2-oxoethyl)-2-(4-aminopyrazol-1-yl)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 43572615 |
| Molecular Formula | C10H17N5O2 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-2-(4-aminopyrazol-1-yl)-N-propan-2-ylacetamide |
| SMILES | CC(C)N(CC(N)=O)C(=O)Cn1cc(N)cn1 |
| InChI | InChI=1S/C10H17N5O2/c1-7(2)15(5-9(12)16)10(17)6-14-4-8(11)3-13-14/h3-4,7H,5-6,11H2,1-2H3,(H2,12,16) |
| InChIKey | ORIICNFEDRVARB-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 107.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |