C13H15FN4O — CID 43574113
2-(4-aminopyrazol-1-yl)-N-[(4-fluorophenyl)methyl]-N-methylacetamide (PubChem CID 43574113) has the molecular formula C13H15FN4O and a molecular weight of 262.29 g/mol. Its IUPAC name is 2-(4-aminopyrazol-1-yl)-N-[(4-fluorophenyl)methyl]-N-methylacetamide.
| Compound Name | 2-(4-aminopyrazol-1-yl)-N-[(4-fluorophenyl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 43574113 |
| Molecular Formula | C13H15FN4O |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2-(4-aminopyrazol-1-yl)-N-[(4-fluorophenyl)methyl]-N-methylacetamide |
| SMILES | CN(Cc1ccc(F)cc1)C(=O)Cn1cc(N)cn1 |
| InChI | InChI=1S/C13H15FN4O/c1-17(7-10-2-4-11(14)5-3-10)13(19)9-18-8-12(15)6-16-18/h2-6,8H,7,9,15H2,1H3 |
| InChIKey | TXSRWVNGNIFCDW-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |