C16H26N2O — CID 43574139
N-ethyl-2-[1-(2,4,5-trimethylphenyl)ethylamino]propanamide (PubChem CID 43574139) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is N-ethyl-2-[1-(2,4,5-trimethylphenyl)ethylamino]propanamide.
| Compound Name | N-ethyl-2-[1-(2,4,5-trimethylphenyl)ethylamino]propanamide |
|---|---|
| PubChem CID | 43574139 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | N-ethyl-2-[1-(2,4,5-trimethylphenyl)ethylamino]propanamide |
| SMILES | CCNC(=O)C(C)NC(C)c1cc(C)c(C)cc1C |
| InChI | InChI=1S/C16H26N2O/c1-7-17-16(19)14(6)18-13(5)15-9-11(3)10(2)8-12(15)4/h8-9,13-14,18H,7H2,1-6H3,(H,17,19) |
| InChIKey | IRVXIKQPSYGOMJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |