C12H13F3N2O3 — CID 43577116
N-cyclopropyl-N-(2-hydroxyethyl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide (PubChem CID 43577116) has the molecular formula C12H13F3N2O3 and a molecular weight of 290.24 g/mol. Its IUPAC name is N-cyclopropyl-N-(2-hydroxyethyl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide.
| Compound Name | N-cyclopropyl-N-(2-hydroxyethyl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 43577116 |
| Molecular Formula | C12H13F3N2O3 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | N-cyclopropyl-N-(2-hydroxyethyl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| SMILES | O=C(c1ccc(C(F)(F)F)[nH]c1=O)N(CCO)C1CC1 |
| InChI | InChI=1S/C12H13F3N2O3/c13-12(14,15)9-4-3-8(10(19)16-9)11(20)17(5-6-18)7-1-2-7/h3-4,7,18H,1-2,5-6H2,(H,16,19) |
| InChIKey | FPKLYJIPSZQMRP-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |