C11H14FNO3S — CID 43577535
N-cyclopropyl-2-fluoro-N-(2-hydroxyethyl)benzenesulfonamide (PubChem CID 43577535) has the molecular formula C11H14FNO3S and a molecular weight of 259.30 g/mol. Its IUPAC name is N-cyclopropyl-2-fluoro-N-(2-hydroxyethyl)benzenesulfonamide.
| Compound Name | N-cyclopropyl-2-fluoro-N-(2-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43577535 |
| Molecular Formula | C11H14FNO3S |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | N-cyclopropyl-2-fluoro-N-(2-hydroxyethyl)benzenesulfonamide |
| SMILES | O=S(=O)(c1ccccc1F)N(CCO)C1CC1 |
| InChI | InChI=1S/C11H14FNO3S/c12-10-3-1-2-4-11(10)17(15,16)13(7-8-14)9-5-6-9/h1-4,9,14H,5-8H2 |
| InChIKey | IYUKOQZOVOQMEQ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |