C11H16N2O5S — CID 43578740
4-[cyclopropyl(2-hydroxyethyl)sulfamoyl]-1-methylpyrrole-2-carboxylic acid (PubChem CID 43578740) has the molecular formula C11H16N2O5S and a molecular weight of 288.32 g/mol. Its IUPAC name is 4-[cyclopropyl(2-hydroxyethyl)sulfamoyl]-1-methylpyrrole-2-carboxylic acid.
| Compound Name | 4-[cyclopropyl(2-hydroxyethyl)sulfamoyl]-1-methylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 43578740 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 4-[cyclopropyl(2-hydroxyethyl)sulfamoyl]-1-methylpyrrole-2-carboxylic acid |
| SMILES | Cn1cc(S(=O)(=O)N(CCO)C2CC2)cc1C(=O)O |
| InChI | InChI=1S/C11H16N2O5S/c1-12-7-9(6-10(12)11(15)16)19(17,18)13(4-5-14)8-2-3-8/h6-8,14H,2-5H2,1H3,(H,15,16) |
| InChIKey | HPXYFYLCPLPFNV-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 99.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |