About (E)-4-oxo-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]but-2-enoic acid
(E)-4-oxo-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]but-2-enoic acid (PubChem CID 43580109) has the molecular formula C10H13F3N2O3
and a molecular weight of 266.22 g/mol. Its IUPAC name is (E)-4-oxo-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]but-2-enoic acid.
Molecular Properties
| Compound Name | (E)-4-oxo-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]but-2-enoic acid |
| PubChem CID | 43580109 |
| Molecular Formula | C10H13F3N2O3 |
| Molecular Weight | 266.22 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | (E)-4-oxo-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]but-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H13F3N2O3/c11-10(12,13)7-14-3-5-15(6-4-14)8(16)1-2-9(17)18/h1-2H,3-7H2,(H,17,18)/b2-1+ |
| InChIKey | RXSOPRTYFCREGV-OWOJBTEDSA-N |
| XLogP | 0.33 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.22 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-oxo-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]but-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-oxo-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]but-2-enoic acid?
The IUPAC name of (E)-4-oxo-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]but-2-enoic acid (CID 43580109) is (E)-4-oxo-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]but-2-enoic acid.
What is the SMILES notation for (E)-4-oxo-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]but-2-enoic acid?
The canonical SMILES for (E)-4-oxo-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]but-2-enoic acid is O=C(O)/C=C/C(=O)N1CCN(CC(F)(F)F)CC1.
What is the InChIKey of (E)-4-oxo-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]but-2-enoic acid?
The InChIKey is RXSOPRTYFCREGV-OWOJBTEDSA-N. The full InChI is InChI=1S/C10H13F3N2O3/c11-10(12,13)7-14-3-5-15(6-4-14)8(16)1-2-9(17)18/h1-2H,3-7H2,(H,17,18)/b2-1+.
What are the key properties of (E)-4-oxo-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]but-2-enoic acid?
(E)-4-oxo-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]but-2-enoic acid has a molecular weight of 266.22 g/mol, XLogP of 0.33, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-oxo-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]but-2-enoic acid is sourced from PubChem (CID 43580109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).